From Wikipedia, the free encyclopedia
Chemical compound
Pharmaceutical compound
ECPLA |
|
| Other names | ECYPLA |
|---|
|
| Legal status |
|
|---|
|
(6aR,9R)-N-Cyclopropyl-N-ethyl-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
|
| Formula | C21H25N3O |
|---|
| Molar mass | 335.451 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
CCN(C1CC1)C(=O)[C@@H]3C=C2c4cccc5ncc(C[C@H]2N(C)C3)c45
|
InChI=1S/C21H25N3O/c1-3-24(15-7-8-15)21(25)14-9-17-16-5-4-6-18-20(16)13(11-22-18)10-19(17)23(2)12-14/h4-6,9,11,14-15,19,22H,3,7-8,10,12H2,1-2H3/t14-,19-/m1/s1 Key:UNUJKEQFYPYXBK-AUUYWEPGSA-N
|
ECPLA (N-ethyl-N-cyclopropyllysergamide) is an analog of lysergic acid diethylamide (LSD) and an isomer of the LSZ developed by Synex Synthetics.[2] In studies in mice, it was found to have approximately 40% the potency of LSD.[3][4]
- ^ "Arrêté du 20 mai 2021 modifiant l'arrêté du 22 février 1990 fixant la liste des substances classées comme stupéfiants". www.legifrance.gouv.fr (in French). 20 May 2021.
- ^ Kavanagh PV, Westphal F, Stratford A, Elliott SP, Dowling G, Halberstadt AL, et al. (2020). "Analytical profile of N-ethyl-N-cyclopropyl lysergamide (ECPLA), an isomer of lysergic acid 2,4-dimethylazetidide (LSZ)". Drug Testing and Analysis. 12 (10): 1514–1521. doi:10.1002/dta.2911. ISSN 1942-7611. PMC 9191644. PMID 32803833.
- ^ Halberstadt AL, Klein LM, Chatha M, Valenzuela LB, Stratford A, Wallach J, et al. (February 2019). "Pharmacological characterization of the LSD analog N-ethyl-N-cyclopropyl lysergamide (ECPLA)". Psychopharmacology. 236 (2): 799–808. doi:10.1007/s00213-018-5055-9. PMC 6848745. PMID 30298278.
- ^ Wagmann L, Richter LH, Kehl T, Wack F, Bergstrand MP, Brandt SD, et al. (July 2019). "In vitro metabolic fate of nine LSD-based new psychoactive substances and their analytical detectability in different urinary screening procedures" (PDF). Analytical and Bioanalytical Chemistry. 411 (19): 4751–4763. doi:10.1007/s00216-018-1558-9. PMID 30617391. S2CID 58615418.
|
|---|
| | No ring subs. | |
|---|
| 4-Hydroxytryptamines | |
|---|
| 5-Hydroxytryptamines | |
|---|
| 5-Methoxytryptamines | |
|---|
| Other ring subs. |
- 2,N,N-TMT
- 4,N,N-TMT
- 5-Bromo-DMT
- 5-N,N-TMT
- 7,N,N-TMT
- 5-Fluoro-DMT
- 5-MeO-2,N,N-TMT
- 5-MeO-4,N,N-TMT
- 6-Fluoro-DMT
- Bretisilocin (GM-2505; 5-fluoro-MET)
|
|---|
| α-Alkyltryptamines | |
|---|
| Others | |
|---|
|
- Ergolines/lysergamides (e.g., LSD)
- Harmala alkaloids and β-carbolines (e.g., harmine, harmaline)
- Iboga alkaloids (e.g., 18-MAC, 18-MC, coronaridine, ibogaine, ibogamine, ME-18-MC, noribogaine, tabernanthine, voacangine)
- Ibogalogs (e.g., ibogainalog)
- Partial ergolines (e.g., NDTDI, RU-28306, DEIMDHPCA, CT-5252)
- Piperidinylethylindoles (e.g., Pip-T)
- Pyrrolidinylethylindoles (e.g., Pyr-T, 5-MeO-pyr-T)
- Pyrrolidinylmethylindoles (e.g., MPMI, 4-HO-MPMI (lucigenol), 5-MeO-MPMI)
|
|---|
|
- Benzofurans (e.g., 5-MeO-DiBF, dimemebfe (5-MeO-BFE), mebfap)
- Benzothiophenes (e.g., 3-APBT)
- Indazoles (e.g., AL-38022A, O-methyl-AL-34662)
- Indenes (e.g., C-DMT)
- Isotryptamines (e.g., 6-MeO-isoDMT, Ro60-0175)
- MYCO-005
- Quinolinylethylamines (e.g., mefloquine)
|
|---|
|
|---|
| | |
|---|
|
- Others: 2C-G-x (e.g., 2C-G-3, 2C-G-5)
- β-Keto-2C-B (βk-2C-B)
- β-Keto-2C-I (βk-2C-I)
- β-Methyl-2C-B (BMB)
- (e.g., BOB, BOD, BOH-2C-B)
- (e.g., HOT-2, HOT-7, HOT-17)
- N-Ethyl-2C-B
- (e.g., 2CD-2-ETO, 2CD-5-ETO, 2CE-5-ETO, 2CE-5iPrO, 2CT2-5-ETO, ASR-2001 (2CB-5PrO))
|
|---|
| |
|---|
| |
|---|
| |
|---|
| |
|---|
| |
|---|
| |
|---|
| Others |
- 2-TOET
- 2-TOM
- 25B-NAcPip
- 4-HA
- 5-TOET
- 5-TOM
- Benzofurans (e.g., 5-APB, 5-APDB, 6-APB, 6-APDB, F-2, F-22)
- Benzothiophenes (e.g., 5-APBT, 6-APBT)
- DMAs (e.g., 2,4-DMA, 3,4-DMA)
- Fenfluramine
- MMA (3-MeO-4-MA)
- Norfenfluramine
- (e.g., 25D-NM-NDEAOP, DOB-NDEPA, DOI-NDEPA, DOM-NDEPA, DOTFM-NDEPA, M-NDEPA, TMA-2-NDEPA)
- PMA (4-MA)
- (e.g., TMA-3, TMA-4, TMA-5, TMA-6)
- TOMSO
- ZDCM-04
|
|---|
|
- 1-Aminomethylindanes (e.g., 2CB-Ind, jimscaline)
- 2-Aminoindanes (e.g., DOM-AI)
- 2-Aminotetralins (e.g., DOM-AT)
- 3-Phenylpiperidines (e.g., LPH-5, LPH-48)
- Benzazepines (e.g., lorcaserin)
- Benzocyclobutenes (e.g., 2CBCB-NBOMe, TCB-2, tomscaline)
- Benzoxepins (e.g., BBOX, IBOX, TFMBOX)
- DMBMPP (juncosamine)
- Ergolines/lysergamides (e.g., LSD)
- Glaucine
- IHCH-7113
- Partial ergolines (e.g., NDTDI, DEIMDHPCA, DEMPDHPCA, DEMTMPDHPCA, DEMNDHPCA)
- Phenylcyclopropylamines (e.g., DMCPA, TMT)
- Phenylmorpholines (phenmetrazines) (e.g., 2C-B-morpholine)
- Phenyloxazolamines (aminorexes) (e.g., 2C-B-aminorex)
- Z3517967757
- ZC-B
|
|---|
|
|---|
| |
|---|
| Others | |
|---|
| Natural sources |
- Tryptamines: Acacia spp. (e.g., Acacia acuminata, Acacia confusa)
- Ayahuasca and vinho de Jurema (e.g., Psychotria viridis (chacruna), Dipolopterys cabrerana (chaliponga, chacruna), Mimosa tenuiflora (Mimosa hostilis; jurema))
- Brosimum (e.g., Brosimum acutifolium (takini))
- Hallucinogenic snuffs (e.g., Anadenanthera peregrina (yopo, jopo, cohoba, parica, ebene), Anadenanthera colubrina (vilca, cebil))
- Incilius alvarius (Bufo alvarius; Colorado River toad, Sonoran Desert toad; bufo)
- Psilocybin-containing mushrooms (magic mushrooms, shrooms) (e.g., Psilocybe cubensis, Psilocybe mexicana (teonanacatl))
|
|---|
|
